cas: 2389-45-9 — see every product listed under this CAS number, including other names
Boc-Lys(Cbz)-OH 98% (CAS 2389-45-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A156665-5g |
| cas | 2389-45-9 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 120.06 Pln | |
| Ambeed | 25g | 164.56 Pln | |
| Ambeed | 100g | 381.50 Pln | |
| Ambeed | 500g | 1371.62 Pln | |
| Ambeed | 1000g | 2673.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A156665 |
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-(phenylmethoxycarbonylamino)hexanoic acid (CAS 2389-45-9) is a chemical compound with the molecular formula C19H28N2O6 and a molecular weight of 380.4 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-(phenylmethoxycarbonylamino)hexanoic acid. InChIKey: BDHUTRNYBGWPBL-HNNXBMFYSA-N.
| Molecular formula | C19H28N2O6 |
|---|---|
| Molecular weight | 380.4 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-(phenylmethoxycarbonylamino)hexanoic acid |
| InChIKey | BDHUTRNYBGWPBL-HNNXBMFYSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCCNC(=O)OCC1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)