cas: 2389-45-9 — see every product listed under this CAS number, including other names
Boc-Lys(Z)-OH, 98.00% (CAS 2389-45-9) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | CM89360M-10g |
| cas | 2389-45-9 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 296.46 Pln | |
| Chemat | 25g | 548.83 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 98.00% |
| category | Chemicals |
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-(phenylmethoxycarbonylamino)hexanoic acid (CAS 2389-45-9) is a chemical compound with the molecular formula C19H28N2O6 and a molecular weight of 380.4 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-(phenylmethoxycarbonylamino)hexanoic acid. InChIKey: BDHUTRNYBGWPBL-HNNXBMFYSA-N.
| Molecular formula | C19H28N2O6 |
|---|---|
| Molecular weight | 380.4 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-(phenylmethoxycarbonylamino)hexanoic acid |
| InChIKey | BDHUTRNYBGWPBL-HNNXBMFYSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCCNC(=O)OCC1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)