cas: 65671-53-6 — see every product listed under this CAS number, including other names
Boc-Lys(Me)2-OH 95% (CAS 65671-53-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A508138-250mg |
| cas | 65671-53-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 286.94 Pln | |
| Ambeed | 1g | 648.50 Pln | |
| Ambeed | 5g | 2267.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A508138 |
(2S)-6-(dimethylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (CAS 65671-53-6) is a chemical compound with the molecular formula C13H26N2O4 and a molecular weight of 274.36 g/mol. IUPAC name: (2S)-6-(dimethylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid. InChIKey: KPXRFYHPDPDJSY-JTQLQIEISA-N.
| Molecular formula | C13H26N2O4 |
|---|---|
| Molecular weight | 274.36 g/mol |
| IUPAC name | (2S)-6-(dimethylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| InChIKey | KPXRFYHPDPDJSY-JTQLQIEISA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCCN(C)C)C(=O)O |
Computed by PubChem (NCBI)