Boc-Lys(Me)2-OH, 95%, 95%
cas: 65671-53-6 — see every product listed under this CAS number, including other names
Boc-Lys(Me)2-OH, 95%, 95% (CAS 65671-53-6) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 1g, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FALF-50mg |
| cas | 65671-53-6 |
| size | 50mg |
| availability | 2g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 304.40 Pln | |
| Chemat | 100mg | 424.40 Pln | |
| Chemat | 1g | 1110.80 Pln | |
| Chemat | 250mg | 587.60 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2S)-6-(dimethylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (CAS 65671-53-6) is a chemical compound with the molecular formula C13H26N2O4 and a molecular weight of 274.36 g/mol. IUPAC name: (2S)-6-(dimethylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid. InChIKey: KPXRFYHPDPDJSY-JTQLQIEISA-N.
| Molecular formula | C13H26N2O4 |
|---|---|
| Molecular weight | 274.36 g/mol |
| IUPAC name | (2S)-6-(dimethylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| InChIKey | KPXRFYHPDPDJSY-JTQLQIEISA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCCN(C)C)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
(2S)-6-(dimethylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid, (2S)-2-{[(tert-butoxy)carbonyl]amino}-6-(dimethylamino)hexanoic acid, (2S)-6-(Dimethylammonio)-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)hexanoate, N2-(tert-Butoxycarbonyl)-N6,N6-dimethyl-L-lysine, Boc-Lys(Me)-OH, Boc-Ne,e-dimethyl-L-lysine, Boc-L-Lys(Me)2-OH, Boc-Lys(Me)?-OH, Boc-Lys(Me2)-OH, (2S)-6-(dimethylazaniumyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate