Boc-Met(O2)-OH, 95%
cas: 60280-45-7 — see every product listed under this CAS number, including other names
Boc-Met(O2)-OH, 95% (CAS 60280-45-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 250mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A642473-1g |
| cas | 60280-45-7 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 231.31 Pln | |
| Ambeed | 25g | 598.44 Pln | |
| Ambeed | 100g | 1950.12 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 174.80 Pln | |
| Chemat | 25g | 462.80 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 242.16 Pln | |
| BLDpharm | 25g | 642.02 Pln | |
| BLDpharm | 100g | 2097.06 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfonylbutanoic acid (CAS 60280-45-7) is a chemical compound with the molecular formula C10H19NO6S and a molecular weight of 281.33 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfonylbutanoic acid. InChIKey: CPGDRHNBSOQFMF-ZETCQYMHSA-N.
| Molecular formula | C10H19NO6S |
|---|---|
| Molecular weight | 281.33 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfonylbutanoic acid |
| InChIKey | CPGDRHNBSOQFMF-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCS(=O)(=O)C)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
(S)-2-((tert-Butoxycarbonyl)amino)-4-(methylsulfonyl)butanoic acid, Boc-Met(O2)-OH, Boc-L-methionine sulfone, Boc-L-Met(O2)-Oh, (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfonylbutanoic acid, N-Boc-L-methionine sulfone, Boc-Met(O?)-OH, N-alpha-t-Butoxycarbonyl-L-methionine sulfone, N-ALPHA-T-BOC-L-METHIONINE-SULFONE, N-alpha-t-Byloxycarbonyl-L-methioninesulfon
