CAS 60280-45-7 appears in our catalog under these names: Boc-L-Met(O2)-OH, Boc-Met(O2)-OH, 95%, 95%, (S)-2-((tert-Butoxycarbonyl)amino)-4-(methylsulfonyl)butanoic acid, 95%, Boc-Met(O2)-OH, 95%. Offered by: Iris Biotech, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 25g, 100g.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfonylbutanoic acid (CAS 60280-45-7) is a chemical compound with the molecular formula C10H19NO6S and a molecular weight of 281.33 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfonylbutanoic acid. InChIKey: CPGDRHNBSOQFMF-ZETCQYMHSA-N.
| Molecular formula | C10H19NO6S |
|---|---|
| Molecular weight | 281.33 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfonylbutanoic acid |
| InChIKey | CPGDRHNBSOQFMF-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCS(=O)(=O)C)C(=O)O |
Computed by PubChem (NCBI)