CAS 74086-45-6 appears in our catalog under these names: Boc-d-methionine sulfone, 95%, Boc–D–methionine sulfone, (2R)-2-{((tert-butoxy)carbonyl)amino}-4-methanesulfonylbutanoic acid. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, 5g, 50mg, 0,5g.
(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfonylbutanoic acid (CAS 74086-45-6) is a chemical compound with the molecular formula C10H19NO6S and a molecular weight of 281.33 g/mol. IUPAC name: (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfonylbutanoic acid. InChIKey: CPGDRHNBSOQFMF-SSDOTTSWSA-N.
| Molecular formula | C10H19NO6S |
|---|---|
| Molecular weight | 281.33 g/mol |
| IUPAC name | (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfonylbutanoic acid |
| InChIKey | CPGDRHNBSOQFMF-SSDOTTSWSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CCS(=O)(=O)C)C(=O)O |
Computed by PubChem (NCBI)