cas: 64263-81-6 — see every product listed under this CAS number, including other names
Boc-N-Me-Tyr(Bzl)-OH, 98% (CAS 64263-81-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch114OHV-100mg |
| cas | 64263-81-6 |
| size | 100mg |
| availability | 39.5g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 122.00 Pln | |
| Chemat | 1g | 194.00 Pln | |
| Chemat | 5g | 482.00 Pln | |
| Chemat | 25g | 1730.00 Pln | |
| Fluorochem | 250mg | 195.78 Pln | |
| Fluorochem | 1g | 289.50 Pln | |
| Fluorochem | 5g | 1013.20 Pln | |
| Fluorochem | 25g | 3319.68 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(4-phenylmethoxyphenyl)propanoic acid (CAS 64263-81-6) is a chemical compound with the molecular formula C22H27NO5 and a molecular weight of 385.5 g/mol. IUPAC name: (2S)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(4-phenylmethoxyphenyl)propanoic acid. InChIKey: FSNRGORPOYPIJC-IBGZPJMESA-N.
| Molecular formula | C22H27NO5 |
|---|---|
| Molecular weight | 385.5 g/mol |
| IUPAC name | (2S)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(4-phenylmethoxyphenyl)propanoic acid |
| InChIKey | FSNRGORPOYPIJC-IBGZPJMESA-N |
| SMILES | CC(C)(C)OC(=O)N(C)[C@@H](CC1=CC=C(C=C1)OCC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)