CAS 64263-81-6 appears in our catalog under these names: Boc–N–Me–Tyr(Bzl)–OH, Boc-L-MeTyr(Bzl)-OH, Boc-N-Me-Tyr(Bzl)-OH, 98%, 98%, Boc-N-Me-Tyr(Bzl)-OH, 98.42%, Boc-N-Me-Tyr(Bzl)-OH, 98%. Offered by: GLPBio, Iris Biotech, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 1g, 25g, 5g, 100mg, 250mg, 250 mg, 1 g, 100 mg.
(2S)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(4-phenylmethoxyphenyl)propanoic acid (CAS 64263-81-6) is a chemical compound with the molecular formula C22H27NO5 and a molecular weight of 385.5 g/mol. IUPAC name: (2S)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(4-phenylmethoxyphenyl)propanoic acid. InChIKey: FSNRGORPOYPIJC-IBGZPJMESA-N.
| Molecular formula | C22H27NO5 |
|---|---|
| Molecular weight | 385.5 g/mol |
| IUPAC name | (2S)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(4-phenylmethoxyphenyl)propanoic acid |
| InChIKey | FSNRGORPOYPIJC-IBGZPJMESA-N |
| SMILES | CC(C)(C)OC(=O)N(C)[C@@H](CC1=CC=C(C=C1)OCC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)