CAS 5068-29-1 appears in our catalog under these names: Z–Tyr(tBu)–OMe, O-(1,1-Dimethylethyl)-N-[(phenylmethoxy)carbonyl]-L-tyrosine methyl ester, 98%, 98%, Z-O-tert-butyl-L-tyrosine methyl ester, 98%, Z-Tyr(tBu)-OMe, 98%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 25g, 5g, 1g, 100g.
Methyl (2S)-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]-2-(phenylmethoxycarbonylamino)propanoate (CAS 5068-29-1) is a chemical compound with the molecular formula C22H27NO5 and a molecular weight of 385.5 g/mol. IUPAC name: methyl (2S)-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]-2-(phenylmethoxycarbonylamino)propanoate. InChIKey: IPRNNTJYTNRIDM-IBGZPJMESA-N.
| Molecular formula | C22H27NO5 |
|---|---|
| Molecular weight | 385.5 g/mol |
| IUPAC name | methyl (2S)-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]-2-(phenylmethoxycarbonylamino)propanoate |
| InChIKey | IPRNNTJYTNRIDM-IBGZPJMESA-N |
| SMILES | CC(C)(C)OC1=CC=C(C=C1)C[C@@H](C(=O)OC)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)