Boc-NH-PEG6-NH2, 95%
cas: 1091627-77-8 — see every product listed under this CAS number, including other names
Boc-NH-PEG6-NH2, 95% (CAS 1091627-77-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 50mg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A383378-100mg |
| cas | 1091627-77-8 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 309.19 Pln | |
| Ambeed | 250mg | 387.06 Pln | |
| Ambeed | 1g | 837.62 Pln | |
| Ambeed | 5g | 2528.62 Pln | |
| Ambeed | 25g | 8436.00 Pln | |
| BLDpharm | 50mg | 264.38 Pln | |
| BLDpharm | 100mg | 325.47 Pln | |
| BLDpharm | 250mg | 414.32 Pln | |
| BLDpharm | 1g | 897.49 Pln | |
| BLDpharm | 5g | 2724.62 Pln | |
| BLDpharm | 25g | 9089.05 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl N-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate (CAS 1091627-77-8) is a chemical compound with the molecular formula C19H40N2O8 and a molecular weight of 424.5 g/mol. IUPAC name: tert-butyl N-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate. InChIKey: HYSRAUNKYCBBFY-UHFFFAOYSA-N.
| Molecular formula | C19H40N2O8 |
|---|---|
| Molecular weight | 424.5 g/mol |
| IUPAC name | tert-butyl N-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate |
| InChIKey | HYSRAUNKYCBBFY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCOCCOCCOCCOCCN |
Computed by PubChem (NCBI)
