cas: 487048-28-2 — see every product listed under this CAS number, including other names
Boc-cis-4-CN-Pro-OMe 98% (CAS 487048-28-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A390780-250mg |
| cas | 487048-28-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 353.69 Pln | |
| Ambeed | 25g | 1327.12 Pln | |
| Ambeed | 100g | 4091.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A390780 |
1-O-tert-butyl 2-O-methyl (2S,4S)-4-cyanopyrrolidine-1,2-dicarboxylate (CAS 487048-28-2) is a chemical compound with the molecular formula C12H18N2O4 and a molecular weight of 254.28 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2S,4S)-4-cyanopyrrolidine-1,2-dicarboxylate. InChIKey: GHLKJIQVORAVHE-BDAKNGLRSA-N.
| Molecular formula | C12H18N2O4 |
|---|---|
| Molecular weight | 254.28 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2S,4S)-4-cyanopyrrolidine-1,2-dicarboxylate |
| InChIKey | GHLKJIQVORAVHE-BDAKNGLRSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](C[C@H]1C(=O)OC)C#N |
Computed by PubChem (NCBI)