cas: 87691-27-8 — see every product listed under this CAS number, including other names
Boc-cis-Hyp-OH 95% (CAS 87691-27-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A138735-250mg |
| cas | 87691-27-8 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 164.56 Pln | |
| Ambeed | 25g | 248.00 Pln | |
| Ambeed | 100g | 770.88 Pln | |
| Ambeed | 500g | 3574.38 Pln | |
| Ambeed | 1000g | 5677.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A138735 |
(2S,4S)-4-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid (CAS 87691-27-8) is a chemical compound with the molecular formula C10H17NO5 and a molecular weight of 231.25 g/mol. IUPAC name: (2S,4S)-4-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid. InChIKey: BENKAPCDIOILGV-BQBZGAKWSA-N.
| Molecular formula | C10H17NO5 |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | (2S,4S)-4-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
| InChIKey | BENKAPCDIOILGV-BQBZGAKWSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](C[C@H]1C(=O)O)O |
Computed by PubChem (NCBI)