CAS 205827-21-0 appears in our catalog under these names: Ethyl 2-(4-(nitromethyl)tetrahydro-2h-pyran-4-yl)acetate, 95%, Ethyl 2–(4–(Nitromethyl)Tetrahydro–2H–Pyran–4–Yl)Acetate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 5g, 25g, 100mg, 250mg.
Ethyl 2-[4-(nitromethyl)oxan-4-yl]acetate (CAS 205827-21-0) is a chemical compound with the molecular formula C10H17NO5 and a molecular weight of 231.25 g/mol. IUPAC name: ethyl 2-[4-(nitromethyl)oxan-4-yl]acetate. InChIKey: LRVRJOBNSSTGDL-UHFFFAOYSA-N.
| Molecular formula | C10H17NO5 |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | ethyl 2-[4-(nitromethyl)oxan-4-yl]acetate |
| InChIKey | LRVRJOBNSSTGDL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1(CCOCC1)C[N+](=O)[O-] |
Computed by PubChem (NCBI)