CAS 1221715-78-1 appears in our catalog under these names: (3-tert-Butoxycarbonylamino-oxetan-3-yl)acetic acid, 95%, 2-(3-((tert-Butoxycarbonyl)amino)oxetan-3-yl)acetic acid, 97%, 2-(3-((tert-Butoxycarbonyl)amino)oxetan-3-yl)acetic acid, 2-(3-((tert-Butoxycarbonyl)amino)oxetan-3-yl)acetic acid, 95%, 95%, 2-(3-((tert-Butoxycarbonyl)amino)oxetan-3-yl)acetic acid, 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 50mg, 0,5g, 500mg, 100mg, 250mg.
2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]oxetan-3-yl]acetic acid (CAS 1221715-78-1) is a chemical compound with the molecular formula C10H17NO5 and a molecular weight of 231.25 g/mol. IUPAC name: 2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]oxetan-3-yl]acetic acid. InChIKey: LOZJYPJBCJFSBL-UHFFFAOYSA-N.
| Molecular formula | C10H17NO5 |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | 2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]oxetan-3-yl]acetic acid |
| InChIKey | LOZJYPJBCJFSBL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1(COC1)CC(=O)O |
Computed by PubChem (NCBI)