cas: 114117-42-9 — see every product listed under this CAS number, including other names
Boc-phe(4-nhac)-oh, 98%, 98% (CAS 114117-42-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 5g, 10g, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111AMD-100mg |
| cas | 114117-42-9 |
| size | 100mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 198.80 Pln | |
| Chemat | 5g | 2253.20 Pln | |
| Chemat | 10g | 3957.20 Pln | |
| Chemat | 250mg | 299.60 Pln | |
| Chemat | 1g | 693.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-3-(4-acetamidophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 114117-42-9) is a chemical compound with the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. IUPAC name: (2S)-3-(4-acetamidophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: ZVPYVOLFCSHVSR-ZDUSSCGKSA-N.
| Molecular formula | C16H22N2O5 |
|---|---|
| Molecular weight | 322.36 g/mol |
| IUPAC name | (2S)-3-(4-acetamidophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | ZVPYVOLFCSHVSR-ZDUSSCGKSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)C[C@@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)