cas: 1704067-02-6 — see every product listed under this CAS number, including other names
Boronic acid, B-[3-[(1,1-dimethylethoxy)methyl]-4-fluorophenyl]-, 95%, 95% (CAS 1704067-02-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AR0N-100mg |
| cas | 1704067-02-6 |
| size | 100mg |
| availability | 6.62g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 578.00 Pln | |
| Chemat | 250mg | 1029.20 Pln | |
| Chemat | 1g | 2474.00 Pln | |
| Chemat | 5g | 5435.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
[4-fluoro-3-[(2-methylpropan-2-yl)oxymethyl]phenyl]boronic acid (CAS 1704067-02-6) is a chemical compound with the molecular formula C11H16BFO3 and a molecular weight of 226.05 g/mol. IUPAC name: [4-fluoro-3-[(2-methylpropan-2-yl)oxymethyl]phenyl]boronic acid. InChIKey: FHQNNKDHTRPIPU-UHFFFAOYSA-N.
| Molecular formula | C11H16BFO3 |
|---|---|
| Molecular weight | 226.05 g/mol |
| IUPAC name | [4-fluoro-3-[(2-methylpropan-2-yl)oxymethyl]phenyl]boronic acid |
| InChIKey | FHQNNKDHTRPIPU-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)F)COC(C)(C)C)(O)O |
Computed by PubChem (NCBI)