Products 2096341-46-5

CAS 2096341-46-5 is the registry number for 2-Butoxy-4-fluoro-5-methylphenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g.

Structural formula: {0} (CAS {1})

(2-butoxy-4-fluoro-5-methylphenyl)boronic acid (CAS 2096341-46-5) is a chemical compound with the molecular formula C11H16BFO3 and a molecular weight of 226.05 g/mol. IUPAC name: (2-butoxy-4-fluoro-5-methylphenyl)boronic acid. InChIKey: QCCNHNTUKBHAAU-UHFFFAOYSA-N.

Identity
Molecular formulaC11H16BFO3
Molecular weight226.05 g/mol
IUPAC name(2-butoxy-4-fluoro-5-methylphenyl)boronic acid
InChIKeyQCCNHNTUKBHAAU-UHFFFAOYSA-N
SMILESB(C1=CC(=C(C=C1OCCCC)F)C)(O)O

Computed by PubChem (NCBI)