CAS 1704067-02-6 appears in our catalog under these names: (3-(tert-Butoxymethyl)-4-fluorophenyl)boronic acid, 95%, (3–(tert–Butoxymethyl)–4–fluorophenyl)boronic acid, Boronic acid, B-[3-[(1,1-dimethylethoxy)methyl]-4-fluorophenyl]-, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 1g, 100mg, 5g, 250mg.
[4-fluoro-3-[(2-methylpropan-2-yl)oxymethyl]phenyl]boronic acid (CAS 1704067-02-6) is a chemical compound with the molecular formula C11H16BFO3 and a molecular weight of 226.05 g/mol. IUPAC name: [4-fluoro-3-[(2-methylpropan-2-yl)oxymethyl]phenyl]boronic acid. InChIKey: FHQNNKDHTRPIPU-UHFFFAOYSA-N.
| Molecular formula | C11H16BFO3 |
|---|---|
| Molecular weight | 226.05 g/mol |
| IUPAC name | [4-fluoro-3-[(2-methylpropan-2-yl)oxymethyl]phenyl]boronic acid |
| InChIKey | FHQNNKDHTRPIPU-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)F)COC(C)(C)C)(O)O |
Computed by PubChem (NCBI)