cas: 899438-46-1 — see every product listed under this CAS number, including other names
Boronic acid, B-7-quinazolinyl-, 95+%, 95+% (CAS 899438-46-1) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IFWD-50mg |
| cas | 899438-46-1 |
| size | 50mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 386.00 Pln | |
| Chemat | 100mg | 611.60 Pln | |
| Chemat | 250mg | 1106.00 Pln | |
| Chemat | 1g | 3160.40 Pln | |
| Chemat | 5g | 11387.60 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
Quinazolin-7-ylboronic acid (CAS 899438-46-1) is a chemical compound with the molecular formula C8H7BN2O2 and a molecular weight of 173.97 g/mol. IUPAC name: quinazolin-7-ylboronic acid. InChIKey: WAPOSZXCZRHKGA-UHFFFAOYSA-N.
| Molecular formula | C8H7BN2O2 |
|---|---|
| Molecular weight | 173.97 g/mol |
| IUPAC name | quinazolin-7-ylboronic acid |
| InChIKey | WAPOSZXCZRHKGA-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=NC=NC=C2C=C1)(O)O |
Computed by PubChem (NCBI)