CAS 1229042-02-7 is the registry number for (1,8-Naphthyridin-3-yl)boronic acid 95+%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
1,8-naphthyridin-3-ylboronic acid (CAS 1229042-02-7) is a chemical compound with the molecular formula C8H7BN2O2 and a molecular weight of 173.97 g/mol. IUPAC name: 1,8-naphthyridin-3-ylboronic acid. InChIKey: BMNLUYBSMOPTMN-UHFFFAOYSA-N.
| Molecular formula | C8H7BN2O2 |
|---|---|
| Molecular weight | 173.97 g/mol |
| IUPAC name | 1,8-naphthyridin-3-ylboronic acid |
| InChIKey | BMNLUYBSMOPTMN-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(N=CC=C2)N=C1)(O)O |
Computed by PubChem (NCBI)