CAS 1443112-44-4 appears in our catalog under these names: [1,5]Naphthyridine-3-boronic acid, 95%, (1,5-Naphthyridin-3-yl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
1,5-naphthyridin-3-ylboronic acid (CAS 1443112-44-4) is a chemical compound with the molecular formula C8H7BN2O2 and a molecular weight of 173.97 g/mol. IUPAC name: 1,5-naphthyridin-3-ylboronic acid. InChIKey: HQRZMWFPSGZGSQ-UHFFFAOYSA-N.
| Molecular formula | C8H7BN2O2 |
|---|---|
| Molecular weight | 173.97 g/mol |
| IUPAC name | 1,5-naphthyridin-3-ylboronic acid |
| InChIKey | HQRZMWFPSGZGSQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=CC=N2)N=C1)(O)O |
Computed by PubChem (NCBI)