Br-PEG4-CH2-Boc 95%
cas: 1807505-29-8 — see every product listed under this CAS number, including other names
Br-PEG4-CH2-Boc 95% (CAS 1807505-29-8) is a chemical reagent available from Chemat. Available pack sizes: 10g, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A751310-10g |
| cas | 1807505-29-8 |
| size | 10g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 5999.62 Pln | |
| Ambeed | 250mg | 292.50 Pln | |
| Ambeed | 1g | 826.50 Pln | |
| Ambeed | 5g | 3774.62 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A751310 |
Tert-butyl 2-[2-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]ethoxy]acetate (CAS 1807505-29-8) is a chemical compound with the molecular formula C14H27BrO6 and a molecular weight of 371.26 g/mol. IUPAC name: tert-butyl 2-[2-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]ethoxy]acetate. InChIKey: PELYBQFWTCXTNW-UHFFFAOYSA-N.
| Molecular formula | C14H27BrO6 |
|---|---|
| Molecular weight | 371.26 g/mol |
| IUPAC name | tert-butyl 2-[2-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]ethoxy]acetate |
| InChIKey | PELYBQFWTCXTNW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)COCCOCCOCCOCCBr |
Computed by PubChem (NCBI)