cas: 16503-32-5 — see every product listed under this CAS number, including other names
Brevilin A 99% (CAS 16503-32-5) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A426347-1mg |
| cas | 16503-32-5 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 231.31 Pln | |
| Ambeed | 5mg | 492.75 Pln | |
| Ambeed | 10mg | 782.00 Pln | |
| Ambeed | 25mg | 1488.44 Pln | |
| Ambeed | 50mg | 2473.00 Pln | |
| Ambeed | 100mg | 3685.62 Pln | |
| Ambeed | 250mg | 6567.00 Pln |
| purity | 99% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A426347 |
[(1S,3aR,5R,5aR,8aR,9S,9aR)-1,5,8a-trimethyl-2,8-dioxo-3a,4,5,5a,9,9a-hexahydro-1H-azuleno[6,5-b]furan-9-yl] (Z)-2-methylbut-2-enoate (CAS 16503-32-5) is a chemical compound with the molecular formula C20H26O5 and a molecular weight of 346.4 g/mol. IUPAC name: [(1S,3aR,5R,5aR,8aR,9S,9aR)-1,5,8a-trimethyl-2,8-dioxo-3a,4,5,5a,9,9a-hexahydro-1H-azuleno[6,5-b]furan-9-yl] (Z)-2-methylbut-2-enoate. InChIKey: KUPPZVXLWANEJJ-UXPPPGSFSA-N.
| Molecular formula | C20H26O5 |
|---|---|
| Molecular weight | 346.4 g/mol |
| IUPAC name | [(1S,3aR,5R,5aR,8aR,9S,9aR)-1,5,8a-trimethyl-2,8-dioxo-3a,4,5,5a,9,9a-hexahydro-1H-azuleno[6,5-b]furan-9-yl] (Z)-2-methylbut-2-enoate |
| InChIKey | KUPPZVXLWANEJJ-UXPPPGSFSA-N |
| SMILES | C/C=C(/C)\C(=O)O[C@H]1[C@@H]2[C@@H](C(=O)O[C@@H]2C[C@H]([C@H]3[C@]1(C(=O)C=C3)C)C)C |
Computed by PubChem (NCBI)