CAS 16503-32-5 appears in our catalog under these names: Brevilin A/ 99.74% (existing batch purity), Brevilin A 99%, Brevilin A, 99.86%, Brevilin A (Standard), Brevilin A, 99%, 99%. Offered by: TargetMol, Ambeed, MedChemExpress, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 250mg.
[(1S,3aR,5R,5aR,8aR,9S,9aR)-1,5,8a-trimethyl-2,8-dioxo-3a,4,5,5a,9,9a-hexahydro-1H-azuleno[6,5-b]furan-9-yl] (Z)-2-methylbut-2-enoate (CAS 16503-32-5) is a chemical compound with the molecular formula C20H26O5 and a molecular weight of 346.4 g/mol. IUPAC name: [(1S,3aR,5R,5aR,8aR,9S,9aR)-1,5,8a-trimethyl-2,8-dioxo-3a,4,5,5a,9,9a-hexahydro-1H-azuleno[6,5-b]furan-9-yl] (Z)-2-methylbut-2-enoate. InChIKey: KUPPZVXLWANEJJ-UXPPPGSFSA-N.
| Molecular formula | C20H26O5 |
|---|---|
| Molecular weight | 346.4 g/mol |
| IUPAC name | [(1S,3aR,5R,5aR,8aR,9S,9aR)-1,5,8a-trimethyl-2,8-dioxo-3a,4,5,5a,9,9a-hexahydro-1H-azuleno[6,5-b]furan-9-yl] (Z)-2-methylbut-2-enoate |
| InChIKey | KUPPZVXLWANEJJ-UXPPPGSFSA-N |
| SMILES | C/C=C(/C)\C(=O)O[C@H]1[C@@H]2[C@@H](C(=O)O[C@@H]2C[C@H]([C@H]3[C@]1(C(=O)C=C3)C)C)C |
Computed by PubChem (NCBI)