Bromobenzene-D5 99,5 atom % D
cas: 4165-57-5 — see every product listed under this CAS number, including other names
Bromobenzene-D5 99,5 atom % D (CAS 4165-57-5) is a chemical reagent available from Chemat. Available pack sizes: 0,7ml, 10ml. Offered by: Deutero.
| brand | Deutero |
|---|---|
| catalog number | 04403-07ml |
| cas | 4165-57-5 |
| size | 0,7ml |
| availability | Germany Stock |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Deutero | 0,7ml | 63.64 Pln | |
| Deutero | 10ml | 570.19 Pln |
properties
| category | Rozpuszczalniki NMR |
|---|---|
| purity | 99,5 atom % D |
| delivery time | 1-2 weeks |
1-bromo-2,3,4,5,6-pentadeuteriobenzene (CAS 4165-57-5) is a chemical compound with the molecular formula C6H5Br and a molecular weight of 162.04 g/mol. IUPAC name: 1-bromo-2,3,4,5,6-pentadeuteriobenzene. InChIKey: QARVLSVVCXYDNA-RALIUCGRSA-N.
| Molecular formula | C6H5Br |
|---|---|
| Molecular weight | 162.04 g/mol |
| IUPAC name | 1-bromo-2,3,4,5,6-pentadeuteriobenzene |
| InChIKey | QARVLSVVCXYDNA-RALIUCGRSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])Br)[2H])[2H] |
Computed by PubChem (NCBI)