CAS 112630-77-0 appears in our catalog under these names: 1-Bromobenzene-13C6, >95% (GC), Bromobenzene–13C6, BROMOBENZENE-13C6, 99 ATOM % 13C, 1-Bromobenzene-13C6. Offered by: TRC, GLPBio, Sigma-Aldrich, MedChemExpress. Available pack sizes: 100mg, 500mg, 1g, 250mg, 50 mg, 10 mg, 100 mg, 25 mg.
Bromo(1,2,3,4,5,6-13C6)cyclohexatriene (CAS 112630-77-0) is a chemical compound with the molecular formula C6H5Br and a molecular weight of 162.96 g/mol. IUPAC name: bromo(1,2,3,4,5,6-13C6)cyclohexatriene. InChIKey: QARVLSVVCXYDNA-IDEBNGHGSA-N.
| Molecular formula | C6H5Br |
|---|---|
| Molecular weight | 162.96 g/mol |
| IUPAC name | bromo(1,2,3,4,5,6-13C6)cyclohexatriene |
| InChIKey | QARVLSVVCXYDNA-IDEBNGHGSA-N |
| SMILES | [13CH]1=[13CH][13CH]=[13C]([13CH]=[13CH]1)Br |
Computed by PubChem (NCBI)