CAS 4165-57-5 appears in our catalog under these names: Bromobenzene-d5, 98%, Bromobenzene-d5, >95% (HPLC), Bromobenzene-d5 (Reagent grade), 99 atom % D, min 99% Chemical Purity, Bromobenzene–d5, Bromobenzene-d_5, 99% (Isotopic) . Offered by: Combi-blocks, TRC, CDN, GLPBio, Thermo Scientific (Alfa Aesar). Available pack sizes: 1g, 100g, 25g, 5g, 10g, 2g, 0,7ml, 10ml.
1-bromo-2,3,4,5,6-pentadeuteriobenzene (CAS 4165-57-5) is a chemical compound with the molecular formula C6H5Br and a molecular weight of 162.04 g/mol. IUPAC name: 1-bromo-2,3,4,5,6-pentadeuteriobenzene. InChIKey: QARVLSVVCXYDNA-RALIUCGRSA-N.
| Molecular formula | C6H5Br |
|---|---|
| Molecular weight | 162.04 g/mol |
| IUPAC name | 1-bromo-2,3,4,5,6-pentadeuteriobenzene |
| InChIKey | QARVLSVVCXYDNA-RALIUCGRSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])Br)[2H])[2H] |
Computed by PubChem (NCBI)