But-3-en-1-yltriphenylphosphonium bromide, 95%
cas: 16958-42-2 — see every product listed under this CAS number, including other names
But-3-en-1-yltriphenylphosphonium bromide, 95% (CAS 16958-42-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg, 10g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A291836-250mg |
| cas | 16958-42-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 181.25 Pln | |
| Ambeed | 1g | 298.06 Pln | |
| Ambeed | 5g | 887.69 Pln | |
| Ambeed | 25g | 2945.81 Pln | |
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 198.80 Pln | |
| Chemat | 5g | 539.60 Pln | |
| Chemat | 10g | 1019.60 Pln | |
| Chemat | 25g | 1749.20 Pln | |
| BLDpharm | 250mg | 192.18 Pln | |
| BLDpharm | 1g | 314.36 Pln | |
| BLDpharm | 5g | 953.02 Pln | |
| BLDpharm | 25g | 3168.91 Pln | |
| Fluorochem | 5g | 732.05 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
But-3-enyl(triphenyl)phosphanium bromide (CAS 16958-42-2) is a chemical compound with the molecular formula C22H22BrP and a molecular weight of 397.3 g/mol. IUPAC name: but-3-enyl(triphenyl)phosphanium bromide. InChIKey: RDJXHDKPXUOJTK-UHFFFAOYSA-M.
| Molecular formula | C22H22BrP |
|---|---|
| Molecular weight | 397.3 g/mol |
| IUPAC name | but-3-enyl(triphenyl)phosphanium bromide |
| InChIKey | RDJXHDKPXUOJTK-UHFFFAOYSA-M |
| SMILES | C=CCC[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[Br-] |
Computed by PubChem (NCBI)
Synonyms:
But-3-en-1-yltriphenylphosphonium bromide, But-3-enyltriphenylphosphonium bromide, RDJXHDKPXUOJTK-UHFFFAOYSA-M, triphenyl(3-butenyl)phosphonium bromide, 3-Buten-1-yltriphenylphosphonium bromide, But-3-en-1-yltriphenylphosphoniumbromide, but-3-enyl(triphenyl)phosphonium;bromide, Phosphonium, 3-butenyltriphenyl-, bromide