CAS 16958-42-2 appears in our catalog under these names: But-3-en-1-yltriphenylphosphonium bromide, 95%, 95%, But-3-en-1-yltriphenylphosphonium bromide, 98%, But-3-en-1-yltriphenylphosphonium bromide, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 10g, 25g.
But-3-enyl(triphenyl)phosphanium bromide (CAS 16958-42-2) is a chemical compound with the molecular formula C22H22BrP and a molecular weight of 397.3 g/mol. IUPAC name: but-3-enyl(triphenyl)phosphanium bromide. InChIKey: RDJXHDKPXUOJTK-UHFFFAOYSA-M.
| Molecular formula | C22H22BrP |
|---|---|
| Molecular weight | 397.3 g/mol |
| IUPAC name | but-3-enyl(triphenyl)phosphanium bromide |
| InChIKey | RDJXHDKPXUOJTK-UHFFFAOYSA-M |
| SMILES | C=CCC[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[Br-] |
Computed by PubChem (NCBI)