CAS 14799-82-7 appears in our catalog under these names: (Cyclopropylmethyl)triphenylphosphonium bromide, 98+% , (Cyclopropylmethyl)triphenylphosphonium bromide, 95%, 95%, (Cyclopropylmethyl)triphenylphosphonium bromide, 95%. Offered by: Thermo Scientific (Alfa Aesar), Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 25g, 250mg, 1g, 10g, 100g, 50g, 500g.
Cyclopropylmethyl(triphenyl)phosphanium bromide (CAS 14799-82-7) is a chemical compound with the molecular formula C22H22BrP and a molecular weight of 397.3 g/mol. IUPAC name: cyclopropylmethyl(triphenyl)phosphanium bromide. InChIKey: WFQSHRSBITUSIB-UHFFFAOYSA-M.
| Molecular formula | C22H22BrP |
|---|---|
| Molecular weight | 397.3 g/mol |
| IUPAC name | cyclopropylmethyl(triphenyl)phosphanium bromide |
| InChIKey | WFQSHRSBITUSIB-UHFFFAOYSA-M |
| SMILES | C1CC1C[P+](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4.[Br-] |
Computed by PubChem (NCBI)