CAS 299405-67-7 appears in our catalog under these names: C-Met inhibitor D9/ 97%, N'-(2-Oxoindolin-3-ylidene)-3-phenylpropanehydrazide, 95%, 95%. Offered by: TargetMol, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 250mg.
N-[(2-hydroxy-1H-indol-3-yl)imino]-3-phenylpropanamide (CAS 299405-67-7) is a chemical compound with the molecular formula C17H15N3O2 and a molecular weight of 293.32 g/mol. IUPAC name: N-[(2-hydroxy-1H-indol-3-yl)imino]-3-phenylpropanamide. InChIKey: YAPAXPKWYKZVFE-UHFFFAOYSA-N.
| Molecular formula | C17H15N3O2 |
|---|---|
| Molecular weight | 293.32 g/mol |
| IUPAC name | N-[(2-hydroxy-1H-indol-3-yl)imino]-3-phenylpropanamide |
| InChIKey | YAPAXPKWYKZVFE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCC(=O)N=NC2=C(NC3=CC=CC=C32)O |
Computed by PubChem (NCBI)