CAS 2412270-22-3 appears in our catalog under these names: CA77·1, CA77.1/ 98.85% (existing batch purity), CA77.1 [CMA Activator], N-(4-(6-Chloroquinoxalin-2-yl)phenyl)acetamide, 98%, 98%, CA77.1, 99.98%. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 10mg, 100mg, 10mM (in 1ml dmso), 25mg, 5mg, 50mg, 10mM/1mL, 25 mg.
N-[4-(6-chloroquinoxalin-2-yl)phenyl]acetamide (CAS 2412270-22-3) is a chemical compound with the molecular formula C16H12ClN3O and a molecular weight of 297.74 g/mol. IUPAC name: N-[4-(6-chloroquinoxalin-2-yl)phenyl]acetamide. InChIKey: ZQXMPDVGBWOTBY-UHFFFAOYSA-N.
| Molecular formula | C16H12ClN3O |
|---|---|
| Molecular weight | 297.74 g/mol |
| IUPAC name | N-[4-(6-chloroquinoxalin-2-yl)phenyl]acetamide |
| InChIKey | ZQXMPDVGBWOTBY-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)C2=CN=C3C=C(C=CC3=N2)Cl |
Computed by PubChem (NCBI)