CAS 199735-88-1 appears in our catalog under these names: CADD522/ 97.74% (existing batch purity), 3-{((3,4-Dichlorophenyl)amino)carbonyl}bicyclo(2.2.1)hept-5-ene-2-carboxylic acid, CADD522 98%, 3-([(3,4-DIchlorophenyl)amino]carbonyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid, 95%, 95%, CADD522, 98.23%. Offered by: TargetMol, Biosynth, Ambeed, Chemat, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 1g, 1mg, 5mg.
3-[(3,4-dichlorophenyl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (CAS 199735-88-1) is a chemical compound with the molecular formula C15H13Cl2NO3 and a molecular weight of 326.2 g/mol. IUPAC name: 3-[(3,4-dichlorophenyl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid. InChIKey: YSDNWNOGHQYWPK-UHFFFAOYSA-N.
| Molecular formula | C15H13Cl2NO3 |
|---|---|
| Molecular weight | 326.2 g/mol |
| IUPAC name | 3-[(3,4-dichlorophenyl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| InChIKey | YSDNWNOGHQYWPK-UHFFFAOYSA-N |
| SMILES | C1C2C=CC1C(C2C(=O)NC3=CC(=C(C=C3)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)