CAS 1239987-91-7 appears in our catalog under these names: CAY10786/ 99.84% (existing batch purity), CAY10786, (2E)-5-Phenyl-1-(2-thienyl)-2-penten-1-one, GPR52 antagonist-1, GPR52 antagonist-1, 99.80%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 1mg.
(E)-5-phenyl-1-thiophen-2-ylpent-2-en-1-one (CAS 1239987-91-7) is a chemical compound with the molecular formula C15H14OS and a molecular weight of 242.3 g/mol. IUPAC name: (E)-5-phenyl-1-thiophen-2-ylpent-2-en-1-one. InChIKey: XUIAIACHIPOOHR-BJMVGYQFSA-N.
| Molecular formula | C15H14OS |
|---|---|
| Molecular weight | 242.3 g/mol |
| IUPAC name | (E)-5-phenyl-1-thiophen-2-ylpent-2-en-1-one |
| InChIKey | XUIAIACHIPOOHR-BJMVGYQFSA-N |
| SMILES | C1=CC=C(C=C1)CC/C=C/C(=O)C2=CC=CS2 |
Computed by PubChem (NCBI)