CAS 315239-63-5 appears in our catalog under these names: ALDH3A1–IN–3, CB29/ 99.51% (existing batch purity), CB29, ALDH3A1-IN-3, 99.43%. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 500mg, 200mg.
N-[4-(4-methylsulfonyl-2-nitroanilino)phenyl]acetamide (CAS 315239-63-5) is a chemical compound with the molecular formula C15H15N3O5S and a molecular weight of 349.4 g/mol. IUPAC name: N-[4-(4-methylsulfonyl-2-nitroanilino)phenyl]acetamide. InChIKey: JXZXJHWSQKISBZ-UHFFFAOYSA-N.
| Molecular formula | C15H15N3O5S |
|---|---|
| Molecular weight | 349.4 g/mol |
| IUPAC name | N-[4-(4-methylsulfonyl-2-nitroanilino)phenyl]acetamide |
| InChIKey | JXZXJHWSQKISBZ-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)NC2=C(C=C(C=C2)S(=O)(=O)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)