CAS 1197397-89-9 appears in our catalog under these names: CBL0137 hydrochloride/ 99.35% (existing batch purity), CBL0137 (hydrochloride), CBL0137 hydrochloride, 1,1'-(9-(2-(Isopropylamino)ethyl)-9H-carbazole-3,6-diyl)diethanone hydrochloride, 99%, 99%, CBL0137 (hydrochloride), 99.72%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 2mg, 10mM (in 1ml dmso).
1-[6-acetyl-9-[2-(propan-2-ylamino)ethyl]carbazol-3-yl]ethanone;hydrochloride (CAS 1197397-89-9) is a chemical compound with the molecular formula C21H25ClN2O2 and a molecular weight of 372.9 g/mol. IUPAC name: 1-[6-acetyl-9-[2-(propan-2-ylamino)ethyl]carbazol-3-yl]ethanone;hydrochloride. InChIKey: IXRKBBVMDMKAEB-UHFFFAOYSA-N.
| Molecular formula | C21H25ClN2O2 |
|---|---|
| Molecular weight | 372.9 g/mol |
| IUPAC name | 1-[6-acetyl-9-[2-(propan-2-ylamino)ethyl]carbazol-3-yl]ethanone;hydrochloride |
| InChIKey | IXRKBBVMDMKAEB-UHFFFAOYSA-N |
| SMILES | CC(C)NCCN1C2=C(C=C(C=C2)C(=O)C)C3=C1C=CC(=C3)C(=O)C.Cl |
Computed by PubChem (NCBI)