CAS 3542-63-0 appears in our catalog under these names: CDK9-IN-10/ 99.8% (existing batch purity), CDK9–IN–10, CDK9-IN-10, CDK9-IN-10, 98.09%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 1mg, 50 mg, 5 mg.
5,8-dihydroxy-2-phenyl-7-phenylmethoxychromen-4-one (CAS 3542-63-0) is a chemical compound with the molecular formula C22H16O5 and a molecular weight of 360.4 g/mol. IUPAC name: 5,8-dihydroxy-2-phenyl-7-phenylmethoxychromen-4-one. InChIKey: OQHAZMRRNANBMN-UHFFFAOYSA-N.
| Molecular formula | C22H16O5 |
|---|---|
| Molecular weight | 360.4 g/mol |
| IUPAC name | 5,8-dihydroxy-2-phenyl-7-phenylmethoxychromen-4-one |
| InChIKey | OQHAZMRRNANBMN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C3=C(C(=C2)O)C(=O)C=C(O3)C4=CC=CC=C4)O |
Computed by PubChem (NCBI)