CAS 864864-17-5 appears in our catalog under these names: CFMTI, CFMTI/ 97.23% (existing batch purity), 2-cyclopropyl-5-[1-(2-fluoropyridin-3-yl)-5-methyl-1H-1,2,3-triazol-4-yl]-2,3-dihydro-1H-isoindol-1-one, CFMTI, 98.0%, CFMTI (Standard). Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 2mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso).
2-cyclopropyl-5-[1-(2-fluoro-3-pyridinyl)-5-methyltriazol-4-yl]-3H-isoindol-1-one (CAS 864864-17-5) is a chemical compound with the molecular formula C19H16FN5O and a molecular weight of 349.4 g/mol. IUPAC name: 2-cyclopropyl-5-[1-(2-fluoro-3-pyridinyl)-5-methyltriazol-4-yl]-3H-isoindol-1-one. InChIKey: XZBFQWRAIYRPPZ-UHFFFAOYSA-N.
| Molecular formula | C19H16FN5O |
|---|---|
| Molecular weight | 349.4 g/mol |
| IUPAC name | 2-cyclopropyl-5-[1-(2-fluoro-3-pyridinyl)-5-methyltriazol-4-yl]-3H-isoindol-1-one |
| InChIKey | XZBFQWRAIYRPPZ-UHFFFAOYSA-N |
| SMILES | CC1=C(N=NN1C2=C(N=CC=C2)F)C3=CC4=C(C=C3)C(=O)N(C4)C5CC5 |
Computed by PubChem (NCBI)