Products 117593-36-9
CAS 117593-36-9 appears in our catalog under these names: CIL62, CIL62/ 97.74% (existing batch purity), CIL62 98%, 9-(2,4-Dihydroxyphenyl)-3,3,6,6-tetramethyl-3,4,5,6,7,9-hexahydro-1H-xanthene-1,8(2H)-dione, 98%, 98%, CIL62, 97.0%. Offered by: GLPBio, TargetMol, Biosynth, Ambeed, Chemat. Available pack sizes: 10mg, 100mg, 50mg, 1mg, 5mg, 25mg, 200mg, 250mg.
9-(2,4-dihydroxyphenyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione (CAS 117593-36-9) is a chemical compound with the molecular formula C23H26O5 and a molecular weight of 382.4 g/mol. IUPAC name: 9-(2,4-dihydroxyphenyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione. InChIKey: OKXVTYXMGOFJFT-UHFFFAOYSA-N.
| Molecular formula | C23H26O5 |
|---|---|
| Molecular weight | 382.4 g/mol |
| IUPAC name | 9-(2,4-dihydroxyphenyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione |
| InChIKey | OKXVTYXMGOFJFT-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(C(C3=C(O2)CC(CC3=O)(C)C)C4=C(C=C(C=C4)O)O)C(=O)C1)C |
Computed by PubChem (NCBI)