Products 1370032-20-4
CAS 1370032-20-4 appears in our catalog under these names: CUR5g/ 98.92% (existing batch purity), CUR5g, CUR5g 99%, CUR5g, 98.69%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 250mg.
(3E,5E)-3-[(4-hydroxyphenyl)methylidene]-5-(1H-indol-3-ylmethylidene)-1-methylpiperidin-4-one (CAS 1370032-20-4) is a chemical compound with the molecular formula C22H20N2O2 and a molecular weight of 344.4 g/mol. IUPAC name: (3E,5E)-3-[(4-hydroxyphenyl)methylidene]-5-(1H-indol-3-ylmethylidene)-1-methylpiperidin-4-one. InChIKey: JMVVTYLZZDOERS-ODPUSEOTSA-N.
| Molecular formula | C22H20N2O2 |
|---|---|
| Molecular weight | 344.4 g/mol |
| IUPAC name | (3E,5E)-3-[(4-hydroxyphenyl)methylidene]-5-(1H-indol-3-ylmethylidene)-1-methylpiperidin-4-one |
| InChIKey | JMVVTYLZZDOERS-ODPUSEOTSA-N |
| SMILES | CN1C/C(=C\C2=CC=C(C=C2)O)/C(=O)/C(=C/C3=CNC4=CC=CC=C43)/C1 |
Computed by PubChem (NCBI)
Synonyms:
orb1744077, orb2900549