CAS 2685779-55-7 appears in our catalog under these names: CYP1B1-IN-4/ 98.38% (existing batch purity), CYP1B1–IN–4, CYP1B1-IN-4 98%, CYP1B1-IN-4, CYP1B1-IN-4, 99.09%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1mg, 200mg.
4-[2-(2,4-dimethoxyphenyl)-1,3-thiazol-4-yl]benzonitrile (CAS 2685779-55-7) is a chemical compound with the molecular formula C18H14N2O2S and a molecular weight of 322.4 g/mol. IUPAC name: 4-[2-(2,4-dimethoxyphenyl)-1,3-thiazol-4-yl]benzonitrile. InChIKey: SCCIDJLIDOUTOW-UHFFFAOYSA-N.
| Molecular formula | C18H14N2O2S |
|---|---|
| Molecular weight | 322.4 g/mol |
| IUPAC name | 4-[2-(2,4-dimethoxyphenyl)-1,3-thiazol-4-yl]benzonitrile |
| InChIKey | SCCIDJLIDOUTOW-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C2=NC(=CS2)C3=CC=C(C=C3)C#N)OC |
Computed by PubChem (NCBI)