Products 407587-33-1
CAS 407587-33-1 appears in our catalog under these names: CaCCinh–A01, CaCCinh-A01/ 99.92% (existing batch purity), CaCCinh-A01 99%, Calcium-activated Chloride C 1PC X 10MG, CaCC(inh)-A01, 99%, 99%. Offered by: GLPBio, TargetMol, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 5 mg.
6-tert-butyl-2-(furan-2-carbonylamino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid (CAS 407587-33-1) is a chemical compound with the molecular formula C18H21NO4S and a molecular weight of 347.4 g/mol. IUPAC name: 6-tert-butyl-2-(furan-2-carbonylamino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid. InChIKey: ACLUEOBQFRYTQS-UHFFFAOYSA-N.
| Molecular formula | C18H21NO4S |
|---|---|
| Molecular weight | 347.4 g/mol |
| IUPAC name | 6-tert-butyl-2-(furan-2-carbonylamino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid |
| InChIKey | ACLUEOBQFRYTQS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1CCC2=C(C1)SC(=C2C(=O)O)NC(=O)C3=CC=CO3 |
Computed by PubChem (NCBI)