CAS 21366-63-2 appears in our catalog under these names: Cannabicyclol (CBL) 100 µg/mL in Methanol, Cannabicyclol (CBL) 1000 µg/mL in Acetonitrile, Cannabicyclol (CBL) 1000 µg/mL in Methanol, Cannabicyclol, Cannabicyclol, Concentration: 10 µg/ml Solvent: Acetonitrile. Offered by: Dr. Ehrenstorfer, Biosynth, HPC Standards. Available pack sizes: 1ml, 5ml, 10ml, 1x1ml.
(1R,9R,12S,14R)-9,13,13-trimethyl-5-pentyl-8-oxatetracyclo[7.4.1.02,7.012,14]tetradeca-2,4,6-trien-3-ol (CAS 21366-63-2) is a chemical compound with the molecular formula C21H30O2 and a molecular weight of 314.5 g/mol. IUPAC name: (1R,9R,12S,14R)-9,13,13-trimethyl-5-pentyl-8-oxatetracyclo[7.4.1.02,7.012,14]tetradeca-2,4,6-trien-3-ol. InChIKey: IGHTZQUIFGUJTG-QSMXQIJUSA-N.
| Molecular formula | C21H30O2 |
|---|---|
| Molecular weight | 314.5 g/mol |
| IUPAC name | (1R,9R,12S,14R)-9,13,13-trimethyl-5-pentyl-8-oxatetracyclo[7.4.1.02,7.012,14]tetradeca-2,4,6-trien-3-ol |
| InChIKey | IGHTZQUIFGUJTG-QSMXQIJUSA-N |
| SMILES | CCCCCC1=CC(=C2[C@@H]3[C@H]4[C@@H](C3(C)C)CC[C@]4(OC2=C1)C)O |
Computed by PubChem (NCBI)