CAS 6087-73-6 appears in our catalog under these names: cis-Delta-9-Tetrahydrocannabinol, (±)–cis–δ9–THC, (±)–cis–δ9–THC (exempt preparation). Offered by: Chemat Brand, GLPBio. Available pack sizes: on request, 1mg.
(6aR,10aS)-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-ol (CAS 6087-73-6) is a chemical compound with the molecular formula C21H30O2 and a molecular weight of 314.5 g/mol. IUPAC name: (6aR,10aS)-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-ol. InChIKey: CYQFCXCEBYINGO-DLBZAZTESA-N.
| Molecular formula | C21H30O2 |
|---|---|
| Molecular weight | 314.5 g/mol |
| IUPAC name | (6aR,10aS)-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-ol |
| InChIKey | CYQFCXCEBYINGO-DLBZAZTESA-N |
| SMILES | CCCCCC1=CC(=C2[C@H]3C=C(CC[C@H]3C(OC2=C1)(C)C)C)O |
Computed by PubChem (NCBI)