Products 1435783-16-6
CAS 1435783-16-6 appears in our catalog under these names: Cannabidiol-D3, Cannabidiol-D3, 0.1mg/ml in Methanol, Cannabidiol-D3, 1mg/ml in Methanol, Cannabidiol–d3 (CRM). Offered by: Lipomed, GLPBio. Available pack sizes: 50mg, 100mg, 10mg, 1ml, 1mg.
2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-(5,5,5-trideuteriopentyl)benzene-1,3-diol (CAS 1435783-16-6) is a chemical compound with the molecular formula C21H30O2 and a molecular weight of 317.5 g/mol. IUPAC name: 2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-(5,5,5-trideuteriopentyl)benzene-1,3-diol. InChIKey: QHMBSVQNZZTUGM-GBXVFRIQSA-N.
| Molecular formula | C21H30O2 |
|---|---|
| Molecular weight | 317.5 g/mol |
| IUPAC name | 2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-(5,5,5-trideuteriopentyl)benzene-1,3-diol |
| InChIKey | QHMBSVQNZZTUGM-GBXVFRIQSA-N |
| SMILES | [2H]C([2H])([2H])CCCCC1=CC(=C(C(=C1)O)[C@@H]2C=C(CC[C@H]2C(=C)C)C)O |
Computed by PubChem (NCBI)