CAS 13956-30-4 is the registry number for (+)–cis–Cannabidiol. Offered by: GLPBio. Available pack sizes: 1mg, 5mg.
2-[(1S,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylbenzene-1,3-diol (CAS 13956-30-4) is a chemical compound with the molecular formula C21H30O2 and a molecular weight of 314.5 g/mol. IUPAC name: 2-[(1S,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylbenzene-1,3-diol. InChIKey: QHMBSVQNZZTUGM-ROUUACIJSA-N.
| Molecular formula | C21H30O2 |
|---|---|
| Molecular weight | 314.5 g/mol |
| IUPAC name | 2-[(1S,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylbenzene-1,3-diol |
| InChIKey | QHMBSVQNZZTUGM-ROUUACIJSA-N |
| SMILES | CCCCCC1=CC(=C(C(=C1)O)[C@H]2C=C(CC[C@H]2C(=C)C)C)O |
Computed by PubChem (NCBI)