Products 1435934-54-5
CAS 1435934-54-5 appears in our catalog under these names: Cannabinol-D3, Cannabinol-D3, 0.1mg/ml in Methanol, Cannabinol-D3, 1mg/ml in Methanol. Offered by: Lipomed. Available pack sizes: 50mg, 100mg, 10mg, 1ml.
6,6,9-trimethyl-3-(5,5,5-trideuteriopentyl)benzo[c]chromen-1-ol (CAS 1435934-54-5) is a chemical compound with the molecular formula C21H26O2 and a molecular weight of 313.4 g/mol. IUPAC name: 6,6,9-trimethyl-3-(5,5,5-trideuteriopentyl)benzo[c]chromen-1-ol. InChIKey: VBGLYOIFKLUMQG-FIBGUPNXSA-N.
| Molecular formula | C21H26O2 |
|---|---|
| Molecular weight | 313.4 g/mol |
| IUPAC name | 6,6,9-trimethyl-3-(5,5,5-trideuteriopentyl)benzo[c]chromen-1-ol |
| InChIKey | VBGLYOIFKLUMQG-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])CCCCC1=CC(=C2C(=C1)OC(C3=C2C=C(C=C3)C)(C)C)O |
Computed by PubChem (NCBI)