cas: 1228312-05-7 — see every product listed under this CAS number, including other names
Carbamic acid, N,N-diethyl-, 9-anthracenylmethyl ester, 97%, 97% (CAS 1228312-05-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JQDX-100mg |
| cas | 1228312-05-7 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 146.00 Pln | |
| Chemat | 5g | 309.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Anthracen-9-ylmethyl N,N-diethylcarbamate (CAS 1228312-05-7) is a chemical compound with the molecular formula C20H21NO2 and a molecular weight of 307.4 g/mol. IUPAC name: anthracen-9-ylmethyl N,N-diethylcarbamate. InChIKey: ZWDNVDDEDBXBMD-UHFFFAOYSA-N.
| Molecular formula | C20H21NO2 |
|---|---|
| Molecular weight | 307.4 g/mol |
| IUPAC name | anthracen-9-ylmethyl N,N-diethylcarbamate |
| InChIKey | ZWDNVDDEDBXBMD-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)OCC1=C2C=CC=CC2=CC3=CC=CC=C31 |
Computed by PubChem (NCBI)