Products 502622-13-1
CAS 502622-13-1 is the registry number for (R)-1-((S)-1-(Naphthalen-1-yl)ethyl)-1-azaspiro[4.4]nonane-2,6-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(5R)-1-[(1S)-1-naphthalen-1-ylethyl]-1-azaspiro[4.4]nonane-2,9-dione (CAS 502622-13-1) is a chemical compound with the molecular formula C20H21NO2 and a molecular weight of 307.4 g/mol. IUPAC name: (5R)-1-[(1S)-1-naphthalen-1-ylethyl]-1-azaspiro[4.4]nonane-2,9-dione. InChIKey: UKLLBFJHPRAKSW-VBKZILBWSA-N.
| Molecular formula | C20H21NO2 |
|---|---|
| Molecular weight | 307.4 g/mol |
| IUPAC name | (5R)-1-[(1S)-1-naphthalen-1-ylethyl]-1-azaspiro[4.4]nonane-2,9-dione |
| InChIKey | UKLLBFJHPRAKSW-VBKZILBWSA-N |
| SMILES | C[C@@H](C1=CC=CC2=CC=CC=C21)N3C(=O)CC[C@@]34CCCC4=O |
Computed by PubChem (NCBI)